(2-methoxyphenyl) 2-phenylbutanoate
Modify Date: 2025-08-25 08:47:17
(2-methoxyphenyl) 2-phenylbutanoate structure
|
Common Name | (2-methoxyphenyl) 2-phenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 40893-04-7 | Molecular Weight | 270.32300 | |
| Density | 1.1g/cm3 | Boiling Point | 371.8ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.8ºC | |
| Name | (2-methoxyphenyl) 2-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 371.8ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 155.8ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.79440 |
| Index of Refraction | 1.548 |
| InChIKey | REXUDYYWQZRUFM-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)Oc1ccccc1OC)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
(2-methoxypheny... CAS#:40893-04-7 |
| Literature: Concellon, Carmen; Duguet, Nicolas; Smith, Andrew D. Advanced Synthesis and Catalysis, 2009 , vol. 351, # 17 p. 3001 - 3009 |
|
~%
(2-methoxypheny... CAS#:40893-04-7 |
| Literature: Di Paco; Tauro Farmaco, Edizione Scientifica, 1956 , vol. 11, p. 540,545 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methoxyphenyl 2-phenylbutanoate |
| 2-Methoxyphenyl 2-phenylbutyrate |
| (+-)-2-Phenyl-buttersaeure-(2-methoxy-phenylester) |
| (+-)-2-phenyl-butyric acid-(2-methoxy-phenyl ester) |