2-chloro-7-ethyl-7-hydroxy-9-oxa-3-azabicyclo[4.4.0]deca-2,4,11-trien-8-one structure
|
Common Name | 2-chloro-7-ethyl-7-hydroxy-9-oxa-3-azabicyclo[4.4.0]deca-2,4,11-trien-8-one | ||
|---|---|---|---|---|
| CAS Number | 40899-34-1 | Molecular Weight | 227.64400 | |
| Density | 1.405g/cm3 | Boiling Point | 439.6ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | 8-chloro-4-ethyl-4-hydroxy-1H-pyrano[3,4-c]pyridin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 439.6ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 219.7ºC |
| Exact Mass | 227.03500 |
| PSA | 59.42000 |
| LogP | 1.38940 |
| Index of Refraction | 1.58 |
| InChIKey | UPJGDVPRPPOLDU-UHFFFAOYSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1ccnc2Cl |
|
~%
2-chloro-7-ethy... CAS#:40899-34-1 |
| Literature: Lyle,R.E. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 3268 - 3271 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 8-chloro-4-ethyl-4-hydroxy-1,4-dihydro-3H-pyrano[3,4-c]pyridin-3-one |
| 8-chloro-4-ethyl-4-hydroxy-1,4-dihydro-pyrano[3,4-c]pyridin-3-one |
| 7-Chlorpyrido<5,4-c>-2-oxo-3-aethyl-3-hydroxy-3,6-dihydropyran |