methyl 4-methoxy-1-oxido-pyridine-3-carboxylate structure
|
Common Name | methyl 4-methoxy-1-oxido-pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 40899-41-0 | Molecular Weight | 183.16100 | |
| Density | 1.22g/cm3 | Boiling Point | 383.8ºC at 760 mmHg | |
| Molecular Formula | C8H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | methyl 4-methoxy-1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 383.8ºC at 760 mmHg |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16100 |
| Flash Point | 185.9ºC |
| Exact Mass | 183.05300 |
| PSA | 60.99000 |
| LogP | 0.91030 |
| Index of Refraction | 1.513 |
| InChIKey | RGSKCQUFHPAMIE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c[n+]([O-])ccc1OC |
|
~%
methyl 4-methox... CAS#:40899-41-0 |
| Literature: Taylor; Crovetti Journal of the American Chemical Society, 1956 , vol. 78, p. 214,216 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| methyl 4-methoxy-1-oxido-pyridine-3-carboxylate |
| 4-methoxy-1-oxy-nicotinic acid methyl ester |
| 4-Methoxy-1-oxy-nicotinsaeure-methylester |
| Methyl-4-methoxynicotinat-N-oxid |