Salutaridine structure
|
Common Name | Salutaridine | ||
|---|---|---|---|---|
| CAS Number | 4090-18-0 | Molecular Weight | 327.374 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 532.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H21NO4 | Melting Point | 198℃ | |
| MSDS | N/A | Flash Point | 275.8±30.1 °C | |
Use of Salutaridine(-)-Salutaridine (Salutaridine) is an alkaloid isolated from the stems of Sinomenium acutum[1]. |
| Name | Sinoacutine |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Salutaridine (Salutaridine) is an alkaloid isolated from the stems of Sinomenium acutum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.5±50.0 °C at 760 mmHg |
| Melting Point | 198℃ |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.374 |
| Flash Point | 275.8±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 59.00000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | GVTRUVGBZQJVTF-ORAYPTAESA-N |
| SMILES | COC1=CC23CCN(C)C(Cc4ccc(OC)c(O)c42)C3=CC1=O |
| Storage condition | -20℃ |
| (9α,13α)-4-Hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one |
| 4-Hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one |
| Salutaridine |
| 5,6,8,14-Tetradehydro-4-hydroxy-3,6-dimethoxy-17-methylmorphinan-7-one |
| Morphinan-7-one, 5,6,8,14-tetradehydro-4-hydroxy-3,6-dimethoxy-17-methyl-, (9α,13α)- |
| Salutarine |
| Sinoacutine |
| Floripavine |
| Morphinan-7-one, 5,6,8,14-tetradehydro-4-hydroxy-3,6-dimethoxy-17-methyl- |