Carbamodithioic acid,N,N-bis(1-methylethyl)-, sodium salt (1:1) structure
|
Common Name | Carbamodithioic acid,N,N-bis(1-methylethyl)-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4092-82-4 | Molecular Weight | 200.32000 | |
| Density | N/A | Boiling Point | 207.1ºC at 760mmHg | |
| Molecular Formula | C7H15NNaS2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.1ºC | |
| Name | sodium,di(propan-2-yl)carbamodithioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 207.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H15NNaS2+ |
| Molecular Weight | 200.32000 |
| Flash Point | 79.1ºC |
| Exact Mass | 200.05400 |
| PSA | 74.13000 |
| LogP | 2.31990 |
| InChIKey | UCMANOMWSXCXDP-UHFFFAOYSA-M |
| SMILES | CC(C)N(C(=S)[S-])C(C)C.[Na+] |
| HS Code | 2930909090 |
|---|
|
~43%
Carbamodithioic... CAS#:4092-82-4 |
| Literature: Bailey, Jane H. E.; Drake, John, E.; Sarkar, Anil B.; Wong, Maria L. Y. Canadian Journal of Chemistry, 1989 , vol. 67, p. 1735 - 1743 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,n-diisopropyldithiocarbamic acid sodium salt |
| Carbamodithioic acid,bis(1-methylethyl)-,sodium salt |
| sodium salt of diisopropyl dithiocarbamate |
| sodium N,N'-diisopropyldithiocarbamate |
| sodium diisopropyl-dithiocarbamate |