Ethyl 4-nitropentanoate structure
|
Common Name | Ethyl 4-nitropentanoate | ||
|---|---|---|---|---|
| CAS Number | 4093-53-2 | Molecular Weight | 175.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-nitropentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H13NO4 |
|---|---|
| Molecular Weight | 175.18200 |
| Exact Mass | 175.08400 |
| PSA | 72.12000 |
| LogP | 1.51810 |
| InChIKey | HSKYYRXKUNNOMT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(C)[N+](=O)[O-] |
| HS Code | 2915900090 |
|---|
|
~%
Ethyl 4-nitrope... CAS#:4093-53-2 |
| Literature: Farooq, Saleem; Sangwan, Payare L.; Aleti, Rajeshwar R.; Chinthakindi, Praveen K.; Qurishi, Mushtaq A.; Koul, Surrinder Tetrahedron Letters, 2012 , vol. 53, # 26 p. 3305 - 3309 |
|
~99%
Ethyl 4-nitrope... CAS#:4093-53-2 |
| Literature: Sebti, Said; Boukhal, Hassan; Hanafi, Naima; Boulaajaj, Said Tetrahedron Letters, 1999 , vol. 40, # 34 p. 6207 - 6209 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 4-Nitro-tritylchlorid |
| Mono-<carbaethoxyaethyl>-nitroaethan |
| 4-nitro-valeric acid ethyl ester |
| 4-nitro-trityl chloride |
| Benzene,1-(chlorodiphenylmethyl)-4-nitro |
| 4-Nitro-valeriansaeure-aethylester |