(2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide
Modify Date: 2025-10-02 00:26:52
![(2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide Structure](https://www.chemsrc.com/extcaspic/271/409366-80-9.png)
(2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide structure
|
Common Name | (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 409366-80-9 | Molecular Weight | 462.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H38N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H38N2O3 |
|---|---|
| Molecular Weight | 462.6 |
| InChIKey | XVLMZQQYJLIZTP-VWLOTQADSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)NC(CCc1ccccc1)CCc1ccccc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Percent recovery of tyrosine hydroxylase immunostaining in mice following 10 mg/kg p....
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL725369
|
|
Name: Percent recovery of tyrosine hydroxylase immunostaining in mice following 10 mg/kg p....
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL725368
|
|
Name: Percent recovery of tyrosine hydroxylase immunostaining in mice following 10 mg/kg p....
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL727781
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: CAS number of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is 409366-80-9. |
| Q: What is the InChIKey of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: InChIKey of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is XVLMZQQYJLIZTP-VWLOTQADSA-N. |
| Q: What is the English name of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: The English name of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide. |
| Q: What is the Chinese name of 409366-80-9? |
| A: Chinese name of 409366-80-9 is 409366-80-9. |
| Q: What is the molecular weight of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: Molecular weight of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is 462.6. |
| Q: What is the molecular formula of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: Molecular formula of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is C29H38N2O3. |
| Q: What is the SMILES notation of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide? |
| A: SMILES notation of (2S)-1-(3,3-Dimethyl-1,2-dioxopentyl)-N-[3-phenyl-1-(2-phenylethyl)propyl]-2-pyrrolidinecarboxamide is CCC(C)(C)C(=O)C(=O)N1CCCC1C(=O)NC(CCc1ccccc1)CCc1ccccc1. |