N-methyl-5-nitro-pyrimidine-4,6-diamine structure
|
Common Name | N-methyl-5-nitro-pyrimidine-4,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 4094-00-2 | Molecular Weight | 169.14100 | |
| Density | 1.545g/cm3 | Boiling Point | 430.2ºC at 760 mmHg | |
| Molecular Formula | C5H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 4-N-methyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 430.2ºC at 760 mmHg |
| Molecular Formula | C5H7N5O2 |
| Molecular Weight | 169.14100 |
| Flash Point | 214ºC |
| Exact Mass | 169.06000 |
| PSA | 109.65000 |
| LogP | 1.18610 |
| Index of Refraction | 1.711 |
| InChIKey | GEMCWVNKCZNIML-UHFFFAOYSA-N |
| SMILES | CNc1ncnc(N)c1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
|
~%
N-methyl-5-nitr... CAS#:4094-00-2 |
| Literature: Daly; Christensen Journal of Organic Chemistry, 1956 , vol. 21, p. 177,178 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-4-amino-6-methylamino-pyrimidin |
| 4-Amino-5-nitro-6-methylaminopyrimidin |
| N4-Methyl-5-nitro-pyrimidin-4,6-diyldiamin |
| N4-methyl-5-nitro-pyrimidine-4,6-diyldiamine |
| N-methyl-5-nitro-pyrimidine-4,6-diamine |
| 4-Amino-6-methylamino-5-nitropyrimidin |