Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate
Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate structure
|
Common Name | Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 40940-16-7 | Molecular Weight | 219.23700 | |
| Density | 1.184g/cm3 | Boiling Point | 359.3ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 171.1ºC |
| Exact Mass | 219.09000 |
| PSA | 58.89000 |
| LogP | 1.76060 |
| Index of Refraction | 1.535 |
| InChIKey | FKECAHDYNXXONJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1C(=O)Nc2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 2,3-dihydro-2-oxo-1H-indole-3-acetate |
| 1-Cyclopentanone-2-acetic acid ethylester |
| Ethyl 2-oxocyclopentylacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: Polar surface area (PSA) of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is 58.89000. |
| Q: What is the InChIKey of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: InChIKey of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is FKECAHDYNXXONJ-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: The English name of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate. |
| Q: What is the CAS number of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: CAS number of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is 40940-16-7. |
| Q: What English synonyms does Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate have? |
| A: English synonyms of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate: ethyl 2,3-dihydro-2-oxo-1H-indole-3-acetate, 1-Cyclopentanone-2-acetic acid ethylester, Ethyl 2-oxocyclopentylacetate. |
| Q: What is the LogP of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: LogP of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is 1.76060. |
| Q: What is the SMILES notation of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: SMILES notation of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is CCOC(=O)CC1C(=O)Nc2ccccc21. |
| Q: What is the molecular formula of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: Molecular formula of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is C12H13NO3. |
| Q: What is the boiling point of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: Boiling point of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is 359.3ºC at 760 mmHg. |
| Q: What is the molecular weight of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate? |
| A: Molecular weight of Ethyl (2-oxo-2,3-dihydro-1H-indol-3-yl)acetate is 219.23700. |