trimethyl(2-trimethylsilyloxypropan-2-yl)silane structure
|
Common Name | trimethyl(2-trimethylsilyloxypropan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 40965-53-5 | Molecular Weight | 204.45700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H24OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(2-trimethylsilyloxypropan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H24OSi2 |
|---|---|
| Molecular Weight | 204.45700 |
| Exact Mass | 204.13700 |
| PSA | 9.23000 |
| LogP | 3.91380 |
| InChIKey | NPVDPCSQNVGVQS-UHFFFAOYSA-N |
| SMILES | CC(C)(O[Si](C)(C)C)[Si](C)(C)C |
|
~%
trimethyl(2-tri... CAS#:40965-53-5 |
| Literature: Dunogues,J. et al. Journal of Organometallic Chemistry, 1973 , vol. 49, p. C9 - C12 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| trimethylsilyl ether of 2-trimethylsilyl-2-propanol |
| [2-Methyl-2-(trimethylsilyl)]-ethyl-(trimethylsilyl)-ether |
| Silane,trimethyl[1-methyl-1-(trimethylsilyl)ethoxy] |