Phenol,4-(1,1-dimethylpropyl)-2,6-dinitro- structure
|
Common Name | Phenol,4-(1,1-dimethylpropyl)-2,6-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 4097-50-1 | Molecular Weight | 254.23900 | |
| Density | 1.305g/cm3 | Boiling Point | 291.1ºC at 760mmHg | |
| Molecular Formula | C11H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.3ºC | |
| Name | 4-(2-methylbutan-2-yl)-2,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 291.1ºC at 760mmHg |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.23900 |
| Flash Point | 115.3ºC |
| Exact Mass | 254.09000 |
| PSA | 111.87000 |
| LogP | 3.94260 |
| Index of Refraction | 1.573 |
| InChIKey | BTFCDCNHRPIDHR-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| HS Code | 2908999090 |
|---|
|
~%
Phenol,4-(1,1-d... CAS#:4097-50-1 |
| Literature: Anschuetz; Rauff Justus Liebigs Annalen der Chemie, 1903 , vol. 327, p. 207 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,6-Dinitro-4-t-amylphenol |
| 3.5-Dinitro-4-hydroxy-1-tert.-pentyl-benzol |
| 2,6-dinitro-4-tert-pentyl-phenol |
| 4-tert-amyl-2,6-dinitrophenol |
| 4-tert-anyl-2,6-dinitrophenol |
| 3.5-Dinitro-4-oxy-1-tert.-amyl-benzol |
| 2.6-Dinitro-4-tert.-amyl-phenol |