2,6-dihydroxy-nicotinic acid ethyl ester
2,6-dihydroxy-nicotinic acid ethyl ester structure
|
Common Name | 2,6-dihydroxy-nicotinic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 40975-40-4 | Molecular Weight | 183.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-dihydroxy-nicotinic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9NO4 |
|---|---|
| Molecular Weight | 183.16100 |
| Exact Mass | 183.05300 |
| PSA | 79.65000 |
| LogP | 0.66950 |
| InChIKey | OYOVEKUWSKJFRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(=O)[nH]c1O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:38496-18-3
CAS#:10357-91-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-Dihydroxy-nicotinsaeure-aethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: SMILES notation of 2,6-dihydroxy-nicotinic acid ethyl ester is CCOC(=O)c1ccc(=O)[nH]c1O. |
| Q: What is the molecular weight of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: Molecular weight of 2,6-dihydroxy-nicotinic acid ethyl ester is 183.16100. |
| Q: What is the LogP of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: LogP of 2,6-dihydroxy-nicotinic acid ethyl ester is 0.66950. |
| Q: What is the InChIKey of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: InChIKey of 2,6-dihydroxy-nicotinic acid ethyl ester is OYOVEKUWSKJFRL-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: Related downstream products(CAS) of 2,6-dihydroxy-nicotinic acid ethyl ester: 38496-18-3;10357-91-2. |
| Q: What English synonyms does 2,6-dihydroxy-nicotinic acid ethyl ester have? |
| A: English synonyms of 2,6-dihydroxy-nicotinic acid ethyl ester: 2,6-Dihydroxy-nicotinsaeure-aethylester. |
| Q: What is the molecular formula of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: Molecular formula of 2,6-dihydroxy-nicotinic acid ethyl ester is C8H9NO4. |
| Q: What is the CAS number of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: CAS number of 2,6-dihydroxy-nicotinic acid ethyl ester is 40975-40-4. |
| Q: What is the English name of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: The English name of 2,6-dihydroxy-nicotinic acid ethyl ester is 2,6-dihydroxy-nicotinic acid ethyl ester. |
| Q: What is the polar surface area (PSA) of 2,6-dihydroxy-nicotinic acid ethyl ester? |
| A: Polar surface area (PSA) of 2,6-dihydroxy-nicotinic acid ethyl ester is 79.65000. |