decaphenyl-tetrasilane structure
|
Common Name | decaphenyl-tetrasilane | ||
|---|---|---|---|---|
| CAS Number | 4098-24-2 | Molecular Weight | 883.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C60H50Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | decaphenyl-tetrasilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C60H50Si4 |
|---|---|
| Molecular Weight | 883.38100 |
| Exact Mass | 882.29900 |
| LogP | 7.08880 |
| InChIKey | PADLYGBOVMIGEM-UHFFFAOYSA-N |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)[Si](c2ccccc2)(c2ccccc2)[Si](c2ccccc2)(c2ccccc2)[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|
~%
decaphenyl-tetr... CAS#:4098-24-2 |
| Literature: Wittenberg et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4812,4814 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Decaphenyl-tetrasilan |
| Dekaphenyltetrasilan |
| Decaphenyltetrasilan |
| DECAPHENYLTETRASILANE |