2-hexyl-4,6-dinitrophenol
Modify Date: 2025-08-25 14:25:05
2-hexyl-4,6-dinitrophenol structure
|
Common Name | 2-hexyl-4,6-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 4099-65-4 | Molecular Weight | 268.26600 | |
| Density | 1.275g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 2-hexyl-4,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.26600 |
| Flash Point | 162.8ºC |
| Exact Mass | 268.10600 |
| PSA | 111.87000 |
| LogP | 4.37780 |
| Index of Refraction | 1.572 |
| InChIKey | UZZSJGULYYQOOY-UHFFFAOYSA-N |
| SMILES | CCCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
|
~%
2-hexyl-4,6-din... CAS#:4099-65-4 |
| Literature: Dutton et al. Canadian Journal of Chemistry, 1953 , vol. 31, p. 837,839 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3.5-Dinitro-2-hydroxy-1-hexyl-benzol |
| EINECS 223-863-7 |
| 3.5-dinitro-2-hydroxy-1-hexyl-benzene |