2-(nitromethylidene)-1-prop-2-enylpyrrolidine
Modify Date: 2025-11-29 17:04:45
2-(nitromethylidene)-1-prop-2-enylpyrrolidine structure
|
Common Name | 2-(nitromethylidene)-1-prop-2-enylpyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 40990-27-0 | Molecular Weight | 168.19300 | |
| Density | 1.18g/cm3 | Boiling Point | 263.3ºC at 760 mmHg | |
| Molecular Formula | C8H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.1ºC | |
| Name | 2-(nitromethylidene)-1-prop-2-enylpyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 263.3ºC at 760 mmHg |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19300 |
| Flash Point | 113.1ºC |
| Exact Mass | 168.09000 |
| PSA | 49.06000 |
| LogP | 1.84740 |
| Index of Refraction | 1.588 |
| InChIKey | LWWSULAJWWHYIC-BQYQJAHWSA-N |
| SMILES | C=CCN1CCCC1=C[N+](=O)[O-] |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(Allyl)-2-(nitromethylene)pyrrolidine |