N-(1,2,3-Thiadiazol-5-yl)phthalimide structure
|
Common Name | N-(1,2,3-Thiadiazol-5-yl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 4100-40-7 | Molecular Weight | 231.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(thiadiazol-5-yl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H5N3O2S |
|---|---|
| Molecular Weight | 231.23100 |
| Exact Mass | 231.01000 |
| PSA | 91.40000 |
| LogP | 1.40370 |
| InChIKey | WFVWGPJGUSYRHT-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1cnns1 |
| HS Code | 2934999090 |
|---|
|
~%
N-(1,2,3-Thiadi... CAS#:4100-40-7 |
| Literature: Pain,D.L.; Slack,R. Journal of the Chemical Society, 1965 , p. 5166 - 5176 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Phthalimido-1,2,3-thiadiazol |
| 1H-Isoindole-1,3(2H)-dione,2-(1,2,3-thiadiazol-5-yl) |
| N-[1,2,3]thiadiazol-5-yl-phthalimide |