Sodium 2-ethyl-1-hexanol dihydrogen phosphate
Modify Date: 2026-06-27 09:51:22
Sodium 2-ethyl-1-hexanol dihydrogen phosphate structure
|
Common Name | Sodium 2-ethyl-1-hexanol dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 4100-43-0 | Molecular Weight | 232.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18NaO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 2-ethyl-1-hexanol dihydrogen phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18NaO4P |
|---|---|
| Molecular Weight | 232.19 |
| InChIKey | FFXZJJYYSMVVIQ-UHFFFAOYSA-M |
| SMILES | CCCCC(CC)COP(=O)([O-])O.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: The English name of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is Sodium 2-ethyl-1-hexanol dihydrogen phosphate. |
| Q: What is the InChIKey of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: InChIKey of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is FFXZJJYYSMVVIQ-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: SMILES notation of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is CCCCC(CC)COP(=O)([O-])O.[Na+]. |
| Q: What is the CAS number of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: CAS number of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is 4100-43-0. |
| Q: What is the Chinese name of 4100-43-0? |
| A: Chinese name of 4100-43-0 is 4100-43-0. |
| Q: What is the molecular weight of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: Molecular weight of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is 232.19. |
| Q: What is the molecular formula of Sodium 2-ethyl-1-hexanol dihydrogen phosphate? |
| A: Molecular formula of Sodium 2-ethyl-1-hexanol dihydrogen phosphate is C8H18NaO4P. |