N-(4-bromophenyl)-2-hydroxy-2,2-diphenyl-acetamide
N-(4-bromophenyl)-2-hydroxy-2,2-diphenyl-acetamide structure
|
Common Name | N-(4-bromophenyl)-2-hydroxy-2,2-diphenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 41007-80-1 | Molecular Weight | 382.25100 | |
| Density | 1.465g/cm3 | Boiling Point | 591.2ºC at 760mmHg | |
| Molecular Formula | C20H16BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,5-dimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 591.2ºC at 760mmHg |
| Molecular Formula | C20H16BrNO2 |
| Molecular Weight | 382.25100 |
| Flash Point | 311.3ºC |
| Exact Mass | 381.03600 |
| PSA | 49.33000 |
| LogP | 4.39670 |
| InChIKey | DLOGMSBDOYDLBO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Br)cc1)C(O)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(4-bromopheny... CAS#:41007-80-1 |
| Literature: Petjunin; Berdinskii Zhurnal Obshchei Khimii, 1951 , vol. 21, p. 1703,1707;engl.Ausg.S.1877,1881 |
|
~%
N-(4-bromopheny... CAS#:41007-80-1 |
| Literature: Petjunin; Berdinskii Zhurnal Obshchei Khimii, 1951 , vol. 21, p. 1703,1707;engl.Ausg.S.1877,1881 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:63483-15-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Dimethylamino-1-benziloyloxy-2.2-dimethyl-propan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: The English name of 1-(3,5-dimethoxyphenyl)ethanone is 1-(3,5-dimethoxyphenyl)ethanone. |
| Q: What is the polar surface area (PSA) of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: Polar surface area (PSA) of 1-(3,5-dimethoxyphenyl)ethanone is 49.33000. |
| Q: What is the boiling point of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: Boiling point of 1-(3,5-dimethoxyphenyl)ethanone is 591.2ºC at 760mmHg. |
| Q: What is the InChIKey of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: InChIKey of 1-(3,5-dimethoxyphenyl)ethanone is DLOGMSBDOYDLBO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 41007-80-1? |
| A: Chinese name of 41007-80-1 is 41007-80-1. |
| Q: What are the upstream materials of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: Related upstream materials(CAS) of 1-(3,5-dimethoxyphenyl)ethanone: 5554-37-0;24451-15-8;16002-63-4. |
| Q: What English synonyms does 1-(3,5-dimethoxyphenyl)ethanone have? |
| A: English synonyms of 1-(3,5-dimethoxyphenyl)ethanone: 3-Dimethylamino-1-benziloyloxy-2.2-dimethyl-propan. |
| Q: What is the molecular formula of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: Molecular formula of 1-(3,5-dimethoxyphenyl)ethanone is C20H16BrNO2. |
| Q: What is the CAS number of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: CAS number of 1-(3,5-dimethoxyphenyl)ethanone is 41007-80-1. |
| Q: What is the molecular weight of 1-(3,5-dimethoxyphenyl)ethanone? |
| A: Molecular weight of 1-(3,5-dimethoxyphenyl)ethanone is 382.25100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |