Wilms tumor protein (33-47)
Modify Date: 2026-07-17 10:04:22
Wilms tumor protein (33-47) structure
|
Common Name | Wilms tumor protein (33-47) | ||
|---|---|---|---|---|
| CAS Number | 410075-16-0 | Molecular Weight | 1526.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C72H103N17O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Wilms tumor protein (33-47) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C72H103N17O20 |
|---|---|
| Molecular Weight | 1526.7 |
| InChIKey | CKVJMFDSGCQHPV-TTYOFHHLSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C1CCCN1C(=O)C(C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(N)=O)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NCC(=O)NC(C)C(=O)NC(CO)C(=O)NC(C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Wilms tumor protein (33-47)? |
| A: Molecular formula of Wilms tumor protein (33-47) is C72H103N17O20. |
| Q: What is the CAS number of Wilms tumor protein (33-47)? |
| A: CAS number of Wilms tumor protein (33-47) is 410075-16-0. |
| Q: What is the Chinese name of 410075-16-0? |
| A: Chinese name of 410075-16-0 is 410075-16-0. |
| Q: What is the molecular weight of Wilms tumor protein (33-47)? |
| A: Molecular weight of Wilms tumor protein (33-47) is 1526.7. |
| Q: What is the InChIKey of Wilms tumor protein (33-47)? |
| A: InChIKey of Wilms tumor protein (33-47) is CKVJMFDSGCQHPV-TTYOFHHLSA-N. |
| Q: What is the English name of Wilms tumor protein (33-47)? |
| A: The English name of Wilms tumor protein (33-47) is Wilms tumor protein (33-47). |
| Q: What is the SMILES notation of Wilms tumor protein (33-47)? |
| A: SMILES notation of Wilms tumor protein (33-47) is CC(C)CC(NC(=O)C(NC(=O)C1CCCN1C(=O)C(C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(N)=O)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(C)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NCC(=O)NC(C)C(=O)NC(CO)C(=O)NC(C)C(=O)O. |