N-(2-chlorophenyl)-3-nitropyridin-2-amine structure
|
Common Name | N-(2-chlorophenyl)-3-nitropyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 41010-66-6 | Molecular Weight | 249.65300 | |
| Density | 1.447g/cm3 | Boiling Point | 353.1ºC at 760 mmHg | |
| Molecular Formula | C11H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | N-(2-chlorophenyl)-3-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760 mmHg |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.65300 |
| Flash Point | 167.3ºC |
| Exact Mass | 249.03100 |
| PSA | 70.74000 |
| LogP | 3.98300 |
| Index of Refraction | 1.679 |
| InChIKey | VAHCZENGIJEIGA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1Nc1ccccc1Cl |
| HS Code | 2933399090 |
|---|
|
~83%
N-(2-chlorophen... CAS#:41010-66-6 |
| Literature: Almirall, S.A. Patent: EP2518071 A1, 2012 ; Location in patent: Page/Page column 44 ; EP 2518071 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2-chloro-phenyl)-(3-nitro-pyridin-2-yl)-amine |
| 2-(o-chloroanilino)-3-nitropyridine |
| N-(2-CHLOROPHENYL)-3-NITRO-PYRIDIN-2-AMINE |