7-(2-hydroxy-2-methylpropyl)-1,3-dimethylpurine-2,6-dione
Modify Date: 2024-01-09 16:54:07
7-(2-hydroxy-2-methylpropyl)-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-(2-hydroxy-2-methylpropyl)-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 41011-04-5 | Molecular Weight | 252.27000 | |
| Density | 1.37g/cm3 | Boiling Point | 483ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.9ºC | |
| Name | 7-(2-hydroxy-2-methylpropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 483ºC at 760 mmHg |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27000 |
| Flash Point | 245.9ºC |
| Exact Mass | 252.12200 |
| PSA | 82.05000 |
| Index of Refraction | 1.631 |
| InChIKey | WIZRYWWFTQBUAD-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CC(C)(C)O)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-(2-hydroxy-2-methylpropyl)-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione |
| 3,7-Dihydro-1,3-dimethyl-7-(2-hydroxy-2-methylpropyl)-1H-purine-2,6-dione |
| 7-(2-hydroxy-2-methyl-propyl)-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 1,3-Dimethyl-7-(2-hydroxy-2-methyl)propyl xanthine |
| 1H-Purine-2,6-dione,3,7-dihydro-1,3-dimethyl-7-(2-hydroxy-2-methylpropyl) |
| Theophylline,7-(2-hydroxy-2-methylpropyl) |