3,5-bis(ethoxycarbonyl)benzoate structure
|
Common Name | 3,5-bis(ethoxycarbonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 4105-93-5 | Molecular Weight | 266.24700 | |
| Density | 1.263g/cm3 | Boiling Point | 432.8ºC at 760 mmHg | |
| Molecular Formula | C13H14O6 | Melting Point | 152-154ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 163.4ºC | |
| Name | 3,5-bis(ethoxycarbonyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 432.8ºC at 760 mmHg |
| Melting Point | 152-154ºC(lit.) |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.24700 |
| Flash Point | 163.4ºC |
| Exact Mass | 266.07900 |
| PSA | 89.90000 |
| LogP | 1.73820 |
| Index of Refraction | 1.538 |
| InChIKey | GAVXMTRMXPWCCV-UHFFFAOYSA-M |
| SMILES | CCOC(=O)c1cc(C(=O)[O-])cc(C(=O)OCC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2918990090 |
|
~73%
3,5-bis(ethoxyc... CAS#:4105-93-5 |
| Literature: Bhosale, Sheshanath V.; Kalyankar, Mohan B.; Langibrd, Steven J.; Bhosale, Sidhanath V.; Oliver, Ruth F. European Journal of Organic Chemistry, 2009 , # 24 p. 4128 - 4134 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-bis(ethoxycarbonyl)benzoic acid |
| 1,3,5-Benzenetricarboxylic acid,diethyl ester |
| MFCD00274230 |
| 3,5-diethoxycarbonylbenzoic acid |
| benzene-1,3,5-tricarboxylic acid diethyl ester |
| diethyl 1,3,5-benzenetricarboxylate |