5-(4-phenylsulfanylphenyl)-2,6-diazabicyclo[5.4.0]undeca-5,7,9,11-tetraene-3-thione structure
|
Common Name | 5-(4-phenylsulfanylphenyl)-2,6-diazabicyclo[5.4.0]undeca-5,7,9,11-tetraene-3-thione | ||
|---|---|---|---|---|
| CAS Number | 41054-49-3 | Molecular Weight | 360.49500 | |
| Density | 1.24g/cm3 | Boiling Point | 526.4ºC at 760 mmHg | |
| Molecular Formula | C21H16N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.1ºC | |
| Name | 4-(4-phenylsulfanylphenyl)-1,3-dihydro-1,5-benzodiazepine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 526.4ºC at 760 mmHg |
| Molecular Formula | C21H16N2S2 |
| Molecular Weight | 360.49500 |
| Flash Point | 272.1ºC |
| Exact Mass | 360.07500 |
| PSA | 81.78000 |
| LogP | 5.67520 |
| Index of Refraction | 1.688 |
| InChIKey | NOKVZZHHQACBIN-UHFFFAOYSA-N |
| SMILES | S=C1CC(c2ccc(Sc3ccccc3)cc2)=Nc2ccccc2N1 |
| HS Code | 2933990090 |
|---|
|
~%
5-(4-phenylsulf... CAS#:41054-49-3 |
| Literature: Recordati S.A. Chemical and Pharmaceutical Company Patent: US3933793 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 255-196-2 |
| 4,p-phenylthiophenyl-1,3-dihydro-2H-1,5-benzodiazepine-2-thione |