5,7-dimethoxy-9,10-dihydrophenanthren-4-ol structure
|
Common Name | 5,7-dimethoxy-9,10-dihydrophenanthren-4-ol | ||
|---|---|---|---|---|
| CAS Number | 41060-06-4 | Molecular Weight | 256.29600 | |
| Density | 1.206g/cm3 | Boiling Point | 467.8ºC at 760mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | 5,7-dimethoxy-9,10-dihydrophenanthren-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 467.8ºC at 760mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 236.7ºC |
| Exact Mass | 256.11000 |
| PSA | 38.69000 |
| LogP | 3.17500 |
| Index of Refraction | 1.609 |
| InChIKey | HCZUQCKKYRIEGM-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1)-c1c(O)cccc1CC2 |
|
~%
5,7-dimethoxy-9... CAS#:41060-06-4 |
| Literature: Letcher,R.M.; Nhamo,L.R.M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1263 - 1265 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-hydroxy-2,4-dimethoxy-9,10-dihydro-phenanthrene |
| Loroglossol |