(S)-hydroprene
Modify Date: 2025-11-25 14:46:46
(S)-hydroprene structure
|
Common Name | (S)-hydroprene | ||
|---|---|---|---|---|
| CAS Number | 41096-47-3 | Molecular Weight | 266.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-hydroprene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H30O2 |
|---|---|
| Molecular Weight | 266.41900 |
| Exact Mass | 266.22500 |
| PSA | 26.30000 |
| LogP | 4.90450 |
| InChIKey | FYQGBXGJFWXIPP-YNBOVDBZSA-N |
| SMILES | CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| S-hydroprene |
| ethyl (2E,4E)-3,7,11-trimethyldodecadienoate |
| ethyl (E,E)-(S)-3,7,11-trimethyldodeca-2,4-dienoate |