2-[(2-oxo-2-phenylethyl)anilino]-1-phenyl-1-ethanone structure
|
Common Name | 2-[(2-oxo-2-phenylethyl)anilino]-1-phenyl-1-ethanone | ||
|---|---|---|---|---|
| CAS Number | 41120-12-1 | Molecular Weight | 329.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-oxo-2-phenylethyl)anilino]-1-phenyl-1-ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H19NO2 |
|---|---|
| Molecular Weight | 329.39200 |
| Exact Mass | 329.14200 |
| PSA | 37.38000 |
| LogP | 4.25880 |
| InChIKey | IZLNJEKOWAGRAB-UHFFFAOYSA-N |
| SMILES | O=C(CN(CC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| HS Code | 2922399090 |
|---|
|
~%
2-[(2-oxo-2-phe... CAS#:41120-12-1 |
| Literature: Paul, Nidhin; Kaladevi, Selvam; Beneto, Arockiam Jesin; Muthusubramanian, Shanmugam; Bhuvanesh, Nattamai Tetrahedron, 2012 , vol. 68, # 34 p. 6892 - 6901 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| diphenacylaniline |
| 1,1'-diphenyl-2,2'-phenylazanediyl-bis-ethanone |
| N,N-Diphenacyl-anilin |
| N,N-diphenacylaniline |