Inophyllum B structure
|
Common Name | Inophyllum B | ||
|---|---|---|---|---|
| CAS Number | 41135-06-2 | Molecular Weight | 404.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Inophyllum BInophyllum B ((+)-Inophyllum B) is a potent HIV Reverse Transcriptase inhibitor with an IC50 value of 38 nM. Inophyllum B inhibits HIV-1 (IC50=1.4 μM) in vitro cell culture. Inophyllum B can be isolated from the acetone extract of the giant African snail, Achatina fulica[1]. |
| Name | (+)-inophyllum B |
|---|---|
| Synonym | More Synonyms |
| Description | Inophyllum B ((+)-Inophyllum B) is a potent HIV Reverse Transcriptase inhibitor with an IC50 value of 38 nM. Inophyllum B inhibits HIV-1 (IC50=1.4 μM) in vitro cell culture. Inophyllum B can be isolated from the acetone extract of the giant African snail, Achatina fulica[1]. |
|---|---|
| Related Catalog | |
| Target |
HIV-1:1.4 μM (IC50) Reverse Transcriptase:38 nM (IC50) |
| References |
| Molecular Formula | C25H24O5 |
|---|---|
| Molecular Weight | 404.45500 |
| Exact Mass | 404.16200 |
| PSA | 68.90000 |
| LogP | 5.09460 |
| InChIKey | BXENDTPSKAICGV-LKBUQDJMSA-N |
| SMILES | CC1Oc2c3c(c4c(-c5ccccc5)cc(=O)oc4c2C(O)C1C)OC(C)(C)C=C3 |
| (10R,11S,12S)-10,11-dihydro-12-hydroxy-4-phenyl-6,6,10,11-tetramethyl-2H,6H,12H-benzo[1,2-b:3,4-b':5,6-b'']tripyran-2-one |
| (10R,11S,12S)-12-Hydroxy-6,6,10,11-tetramethyl-4-phenyl-11,12-dihydro-6H,10H-dipyrano[2,3-f |
| 2',3'-h]chromen-2-one |
| inophyllum B |
| inophyllum-B |