Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)
Modify Date: 2026-07-19 12:48:23
Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) structure
|
Common Name | Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) | ||
|---|---|---|---|---|
| CAS Number | 41136-23-6 | Molecular Weight | 326.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H30O2 |
|---|---|
| Molecular Weight | 326.5 |
| InChIKey | OJZFPWMOQIFNQK-SZPZYZBQSA-N |
| SMILES | CCCCC(c1ccc(O)cc1)C(CCCC)c1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 41136-23-6? |
| A: Chinese name of 41136-23-6 is 41136-23-6. |
| Q: What is the molecular formula of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: Molecular formula of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is C22H30O2. |
| Q: What is the molecular weight of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: Molecular weight of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is 326.5. |
| Q: What is the CAS number of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: CAS number of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is 41136-23-6. |
| Q: What is the SMILES notation of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: SMILES notation of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is CCCCC(c1ccc(O)cc1)C(CCCC)c1ccc(O)cc1. |
| Q: What is the InChIKey of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: InChIKey of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is OJZFPWMOQIFNQK-SZPZYZBQSA-N. |
| Q: What is the English name of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*)? |
| A: The English name of Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*) is Phenol, 4,4a(2)-(1,2-dibutyl-1,2-ethanediyl)bis-, (R*,S*). |