(4-nitrophenyl) 2-(2,4-dioxopyrimidin-1-yl)acetate structure
|
Common Name | (4-nitrophenyl) 2-(2,4-dioxopyrimidin-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 4114-03-8 | Molecular Weight | 291.21600 | |
| Density | 1.495g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Molecular Formula | C12H9N3O6 |
| Molecular Weight | 291.21600 |
| Exact Mass | 291.04900 |
| PSA | 126.98000 |
| LogP | 0.57360 |
| Index of Refraction | 1.608 |
| InChIKey | IESQDQSVLHTSHT-UHFFFAOYSA-N |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-acetic acid 4-nitro-phenyl ester |
| 1-carboxymethyluracil-4-nitrophenyl ester |
| 4-nitrophenyl(2,4-dioxo-3,4-dihydropyrimidin-1(2h)-yl)acetate |