(4-pentylphenyl) 3-chloro-4-(4-pentylbenzoyl)oxybenzoate structure
|
Common Name | (4-pentylphenyl) 3-chloro-4-(4-pentylbenzoyl)oxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 41161-54-0 | Molecular Weight | 493.03400 | |
| Density | 1.138g/cm3 | Boiling Point | 634.8ºC at 760 mmHg | |
| Molecular Formula | C30H33ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | (4-pentylphenyl) 3-chloro-4-(4-pentylbenzoyl)oxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 634.8ºC at 760 mmHg |
| Molecular Formula | C30H33ClO4 |
| Molecular Weight | 493.03400 |
| Flash Point | 195ºC |
| Exact Mass | 492.20700 |
| PSA | 52.60000 |
| LogP | 8.24380 |
| Index of Refraction | 1.566 |
| InChIKey | ANVGYLDROLBYEZ-UHFFFAOYSA-N |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(CCCCC)cc3)c(Cl)c2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,3-chloro-4-((4-pentylbenzoyl)oxy)-,4-pentylphenyl ester |
| p-Pentylphenyl 4-(p-pentylbenzoyloxy)-3-chlorobenzoate |
| 4-n-amylphenyl-2-chloro-4(4'-amylbenzoylhydroxy)benzoate |
| 4,n-pentylphenyl,(pentyl-benzoyloxy)-3-chlorobenzoate |