7-hydroxy Pestalotin
Modify Date: 2025-08-25 12:58:03
7-hydroxy Pestalotin structure
|
Common Name | 7-hydroxy Pestalotin | ||
|---|---|---|---|---|
| CAS Number | 41164-59-4 | Molecular Weight | 230.25800 | |
| Density | 1.2g/cm3 | Boiling Point | 456.7ºC at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.3ºC | |
Use of 7-hydroxy Pestalotin7-Hydroxypestalotin (LL-P880β) is a fungal metabolite[1]. |
| Name | 2-(1,2-dihydroxypentyl)-4-methoxy-2,3-dihydropyran-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Hydroxypestalotin (LL-P880β) is a fungal metabolite[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| References |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760 mmHg |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.25800 |
| Flash Point | 178.3ºC |
| Exact Mass | 230.11500 |
| PSA | 75.99000 |
| LogP | 0.35410 |
| Index of Refraction | 1.509 |
| InChIKey | YLHOHANRUSKHKO-PCFYAGROSA-N |
| SMILES | CCCC(O)C(O)C1CC(OC)=CC(=O)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (6S,1'S,2'R)-6-(1',2'-Dihydroxypentyl)-5,6-dihydro-4-methoxypyrane-2-one |
| LL-P880beta |
| 7-Hydroxypestalotin |
| hydroxypestalotin |