2-bromoethyl 3,4,5-trimethoxybenzoate structure
|
Common Name | 2-bromoethyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 41165-35-9 | Molecular Weight | 319.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromoethyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15BrO5 |
|---|---|
| Molecular Weight | 319.14900 |
| Exact Mass | 318.01000 |
| PSA | 53.99000 |
| LogP | 2.26410 |
| InChIKey | GIOOQVMMXDFBAW-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OCCBr)cc(OC)c1OC |
|
~%
2-bromoethyl 3,... CAS#:41165-35-9 |
| Literature: Searle and Co. Patent: US2852520 , 1957 ; Full Text Show Details Searle and Co. Patent: US2800475 , 1955 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-bromoethyl-3,4,5-trimethoxybenzoate |
| 3,4,5-trimethoxy-benzoic acid-(2-bromo-ethyl ester) |
| 3,4,5-Trimethoxy-benzoesaeure-<2-brom-ethylester> |
| 3,4,5-Trimethoxy-benzoesaeure-(2-brom-aethylester) |
| Benzoic acid,3,4,5-trimethoxy-,2-bromoethyl ester |