ethene,ethyl prop-2-enoate,furan-2,5-dione structure
|
Common Name | ethene,ethyl prop-2-enoate,furan-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 41171-14-6 | Molecular Weight | 226.22600 | |
| Density | 0.94 g/mL at 25ºC(lit.) | Boiling Point | 99.5ºC at 760 mmHg | |
| Molecular Formula | C11H14O5 | Melting Point | 92ºC | |
| MSDS | N/A | Flash Point | 15.6ºC | |
| Name | ethene,ethyl prop-2-enoate,furan-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 99.5ºC at 760 mmHg |
| Melting Point | 92ºC |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.22600 |
| Flash Point | 15.6ºC |
| Exact Mass | 226.08400 |
| PSA | 69.67000 |
| LogP | 1.16370 |
| InChIKey | GURLTLRQWSAAIX-UHFFFAOYSA-N |
| SMILES | C=C.C=CC(=O)OCC.O=C1C=CC(=O)O1 |
| 2-Propenoic acid,ethyl ester,polymer with ethene and 2,5-furandione |
| MFCD00212542 |