N,N-dihexylbenzene-1,4-dicarboxamide structure
|
Common Name | N,N-dihexylbenzene-1,4-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 41203-68-3 | Molecular Weight | 332.48000 | |
| Density | 0.991g/cm3 | Boiling Point | 533.1ºC at 760 mmHg | |
| Molecular Formula | C20H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8ºC | |
| Name | 4-N,4-N-dihexylbenzene-1,4-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.991g/cm3 |
|---|---|
| Boiling Point | 533.1ºC at 760 mmHg |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.48000 |
| Flash Point | 166.8ºC |
| Exact Mass | 332.24600 |
| PSA | 58.20000 |
| LogP | 5.08860 |
| Index of Refraction | 1.507 |
| InChIKey | NNGQKAZLMMHZDR-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=O)c1ccc(C(=O)NCCCCCC)cc1 |
| HS Code | 2924299090 |
|---|
|
~87%
N,N-dihexylbenz... CAS#:41203-68-3 |
| Literature: Malineni, Jagadeesh; Merkens, Carina; Keul, Helmut; Moeller, Martin Catalysis Communications, 2013 , vol. 40, p. 80 - 83 |
|
~%
N,N-dihexylbenz... CAS#:41203-68-3 |
| Literature: Jones; Ossowski; Kus Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2002 , vol. 57, # 8 p. 914 - 921 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-dihexyl-tetrephthaldiamide |
| N,N-DIHEXYLBENZENE-1,4-DICARBOXAMIDE |