Ethyl bromo(3,4-dichlorophenyl)acetate structure
|
Common Name | Ethyl bromo(3,4-dichlorophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 41204-08-4 | Molecular Weight | 311.987 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 331.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H9BrCl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4±26.5 °C | |
| Name | ethyl 2-bromo-2-(3,4-dichlorophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.6±37.0 °C at 760 mmHg |
| Molecular Formula | C10H9BrCl2O2 |
| Molecular Weight | 311.987 |
| Flash Point | 154.4±26.5 °C |
| Exact Mass | 309.916290 |
| PSA | 26.30000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | YFJFMJXQSOSNLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
|
~79%
Ethyl bromo(3,4... CAS#:41204-08-4 |
| Literature: Epstein, Joseph W.; Brabander, Herbert J.; Fanshawe, William J.; Hofmann, Corris M.; McKenzie, Thomas C.; et al. Journal of Medicinal Chemistry, 1981 , vol. 24, # 5 p. 481 - 490 |
|
~%
Ethyl bromo(3,4... CAS#:41204-08-4 |
| Literature: EUTHYMIC BIOSCIENCE, INC.; MCKINNEY, Anthony, Alexander; BYMASTER, Frank; PISKORSKI, Walter Patent: WO2012/75473 A1, 2012 ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzeneacetic acid, α-bromo-3,4-dichloro-, ethyl ester |
| |A-Bromo-3,4-dichlorophenylacetic acid ethyl ester |
| Ethyl α.-bromo-3,4-dichlorobenzeneacetate |
| ZLD0509 |
| 2'-Bromo-3,4-dichlorophenylacetic acid ethyl ester |
| Ethyl bromo(3,4-dichlorophenyl)acetate |
| Bromo-3,4-dichlorophenylacetic acid ethyl ester |
| GR BG DYEVO2 |