(4-methoxyphenyl)-(2-methylphenyl)methanone
Modify Date: 2025-09-16 12:57:50
(4-methoxyphenyl)-(2-methylphenyl)methanone structure
|
Common Name | (4-methoxyphenyl)-(2-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 41204-59-5 | Molecular Weight | 226.27000 | |
| Density | 1.088g/cm3 | Boiling Point | 336.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | (4-methoxyphenyl)-(2-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 336.9ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 144.3ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.23460 |
| Index of Refraction | 1.563 |
| InChIKey | VPAQGAOJFZBBTK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2C)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-methyl-4'-methoxybenzophenone |
| 4-METHOXY-2'-METHYLBENZOPHENONE |
| 4-Methoxyphenyl 2-methylphenyl ketone |