thicrofos
Modify Date: 2025-09-18 21:15:07
thicrofos structure
|
Common Name | thicrofos | ||
|---|---|---|---|---|
| CAS Number | 41219-32-3 | Molecular Weight | 352.83700 | |
| Density | 1.33g/cm3 | Boiling Point | 429.7ºC at 760 mmHg | |
| Molecular Formula | C13H18ClO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | thicrofos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760 mmHg |
| Molecular Formula | C13H18ClO3PS2 |
| Molecular Weight | 352.83700 |
| Flash Point | 213.7ºC |
| Exact Mass | 352.01200 |
| PSA | 95.94000 |
| LogP | 5.79120 |
| Index of Refraction | 1.583 |
| InChIKey | VIRFVCLSHYKKRP-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SC1CCSc2ccc(Cl)cc21 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-4-diethoxyphosphorylsulfanyl-3,4-dihydro-2H-thiochromene |
| S-[(RS)-6-chloro-3,4-dihydro-2H-1-benzothiin-4-yl] O,O-diethyl phosphorothioate |
| Thicrofos |
| rac-S-[(4R-6-chloro-3,4-dihydro-2H-1-benzothiopyran-4-yl] O,O-diethyl phosphorothioate |
| S-(6-chloro-3,4-dihydro-2H-1-benzothiopyran-4-yl) O,O-diethyl phosphorothioate |
| Thicrofos [ISO] |