N-Boc-4-Dimethylaminopiperidine
Modify Date: 2025-09-11 13:59:02
N-Boc-4-Dimethylaminopiperidine structure
|
Common Name | N-Boc-4-Dimethylaminopiperidine | ||
|---|---|---|---|---|
| CAS Number | 412293-88-0 | Molecular Weight | 228.33100 | |
| Density | 1.012g/cm3 | Boiling Point | 295.431ºC at 760 mmHg | |
| Molecular Formula | C12H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.472ºC | |
| Name | tert-butyl 4-(dimethylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 295.431ºC at 760 mmHg |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.33100 |
| Flash Point | 132.472ºC |
| Exact Mass | 228.18400 |
| PSA | 32.78000 |
| LogP | 1.88540 |
| Index of Refraction | 1.49 |
| InChIKey | DOMCYLWSTZEWTQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~%
N-Boc-4-Dimethy... CAS#:412293-88-0 |
| Literature: Synthetic Communications, , vol. 39, # 2 p. 273 - 277 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:4876-59-9| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-dimethylaminopiperidine-1-carboxylic acid tert-butyl ester |
| N-Boc-4-dimethylaminopiperidine |