ethyl (5-amino-3-methyl-oxazol-4-yl)carbamoylformate structure
|
Common Name | ethyl (5-amino-3-methyl-oxazol-4-yl)carbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 41230-57-3 | Molecular Weight | 213.19100 | |
| Density | 1.388g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(5-amino-3-methyl-1,2-oxazol-4-yl)amino]-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19100 |
| Exact Mass | 213.07500 |
| PSA | 107.45000 |
| LogP | 0.72100 |
| Index of Refraction | 1.578 |
| InChIKey | ZAYNQQKBMRUIKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1c(C)noc1N |
| HS Code | 2934999090 |
|---|
|
~%
ethyl (5-amino-... CAS#:41230-57-3 |
| Literature: Abushanab,E. et al. Journal of Heterocyclic Chemistry, 1973 , vol. 10, p. 181 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-4-aethyloxalylamido-3-methylisoxazol |