tert-butyl N-(1-benzofuran-4-yl)carbamate
tert-butyl N-(1-benzofuran-4-yl)carbamate structure
|
Common Name | tert-butyl N-(1-benzofuran-4-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 412336-05-1 | Molecular Weight | 233.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(1-benzofuran-4-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO3 |
|---|---|
| Molecular Weight | 233.26300 |
| Exact Mass | 233.10500 |
| PSA | 51.47000 |
| LogP | 3.85280 |
| InChIKey | JNWQRYMPARVORS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc2occc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tert-butyl N-(1... CAS#:412336-05-1 |
| Literature: Lambert, Christine Marie Paul; Ple, Patrick Patent: US2004/44015 A1, 2004 ; |
|
~%
tert-butyl N-(1... CAS#:412336-05-1 |
| Literature: Ple, Patrick A.; Green, Tim P.; Hennequin, Laurent F.; Curwen, Jon; Fennell, Michael; Allen, Jack; Lambert-Van Der Brempt, Christine; Costello, Gerard Journal of Medicinal Chemistry, 2004 , vol. 47, # 4 p. 871 - 887 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl benzofuran-4-carbamate |
| TERT-BUTYL 1-BENZOFURAN-4-YLCARBAMATE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(1-benzofuran-4-yl)carbamate is CC(C)(C)OC(=O)Nc1cccc2occc12. |
| Q: What is the CAS number of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: CAS number of tert-butyl N-(1-benzofuran-4-yl)carbamate is 412336-05-1. |
| Q: What is the English name of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: The English name of tert-butyl N-(1-benzofuran-4-yl)carbamate is tert-butyl N-(1-benzofuran-4-yl)carbamate. |
| Q: What English synonyms does tert-butyl N-(1-benzofuran-4-yl)carbamate have? |
| A: English synonyms of tert-butyl N-(1-benzofuran-4-yl)carbamate: tert-butyl benzofuran-4-carbamate, TERT-BUTYL 1-BENZOFURAN-4-YLCARBAMATE. |
| Q: What is the polar surface area (PSA) of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-(1-benzofuran-4-yl)carbamate is 51.47000. |
| Q: What is the InChIKey of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: InChIKey of tert-butyl N-(1-benzofuran-4-yl)carbamate is JNWQRYMPARVORS-UHFFFAOYSA-N. |
| Q: What is the LogP of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: LogP of tert-butyl N-(1-benzofuran-4-yl)carbamate is 3.85280. |
| Q: What is the molecular weight of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(1-benzofuran-4-yl)carbamate is 233.26300. |
| Q: What is the molecular formula of tert-butyl N-(1-benzofuran-4-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(1-benzofuran-4-yl)carbamate is C13H15NO3. |