4-benzo[1,3]dioxol-5-yl-2-(3,4-dimethoxyphenyl)-4-oxo-butanoic acid structure
|
Common Name | 4-benzo[1,3]dioxol-5-yl-2-(3,4-dimethoxyphenyl)-4-oxo-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 41303-68-8 | Molecular Weight | 358.34200 | |
| Density | 1.33g/cm3 | Boiling Point | 588.2ºC at 760 mmHg | |
| Molecular Formula | C19H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | 4-(1,3-benzodioxol-5-yl)-2-(3,4-dimethoxyphenyl)-4-oxobutanoic acid |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 588.2ºC at 760 mmHg |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.34200 |
| Flash Point | 213.2ºC |
| Exact Mass | 358.10500 |
| PSA | 91.29000 |
| LogP | 2.87370 |
| Index of Refraction | 1.592 |
| InChIKey | NBFZNUCGNPYQHC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CC(=O)c2ccc3c(c2)OCO3)C(=O)O)cc1OC |
| HS Code | 2932999099 |
|---|
|
~%
4-benzo[1,3]dio... CAS#:41303-68-8 |
| Literature: Ishii; Kawanabe; Harada; et al. Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 9 p. 3039 - 3055 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |