2,3-dimethoxy-4b,5,6,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]phenanthridine structure
|
Common Name | 2,3-dimethoxy-4b,5,6,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]phenanthridine | ||
|---|---|---|---|---|
| CAS Number | 41303-71-3 | Molecular Weight | 337.36900 | |
| Density | 1.4g/cm3 | Boiling Point | 473.9ºC at 760 mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 2,3-dimethoxy-4b,5,6,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]phenanthridine |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 473.9ºC at 760 mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.36900 |
| Flash Point | 192.8ºC |
| Exact Mass | 337.13100 |
| PSA | 49.28000 |
| LogP | 3.07170 |
| Index of Refraction | 1.672 |
| InChIKey | UBXDBDSVSACXOQ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C1CCc3cc4c(cc3C1N=C2)OCO4 |
|
~%
2,3-dimethoxy-4... CAS#:41303-71-3 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Heterocyclic Chemistry, 1973 , vol. 10, p. 85 - 88 |