ethyl 4-(4-fluorophenyl)-4-oxobutanoate structure
|
Common Name | ethyl 4-(4-fluorophenyl)-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 41310-80-9 | Molecular Weight | 224.22800 | |
| Density | 1.151g/cm3 | Boiling Point | 330ºC at 760 mmHg | |
| Molecular Formula | C12H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4ºC | |
| Name | ethyl 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 330ºC at 760 mmHg |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.22800 |
| Flash Point | 148.4ºC |
| Exact Mass | 224.08500 |
| PSA | 43.37000 |
| LogP | 2.35170 |
| Index of Refraction | 1.493 |
| InChIKey | RCIGNAZAPKOTIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)c1ccc(F)cc1 |
| HS Code | 2918300090 |
|---|
|
~90%
ethyl 4-(4-fluo... CAS#:41310-80-9 |
| Literature: Jefford; Kohmoto; Jaggi; Timari; Rossier; Rudaz; Barbuzzi; Gerard; Burger; Kamalaprija; Mareda; Bernardinelli; Manzanares; Canfield; Fleck; Robinson; Peters Helvetica Chimica Acta, 1995 , vol. 78, # 3 p. 647 - 662 |
|
~%
ethyl 4-(4-fluo... CAS#:41310-80-9 |
| Literature: Imoto, Hiroshi; Sugiyama, Yasuo; Kimura, Hiroyuki; Momose, Yu Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 2 p. 138 - 151 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 3-(4-fluorobenzoyl)propanoate |
| ethyl 4-(4-fluorophenyl)-4-oxo-butyrate |
| Ethyl-3-(4-fluorobenzoyl)propionat |