4,4'-Bis(dimethylamino) dithiobenzil
Modify Date: 2026-06-30 16:21:43
4,4'-Bis(dimethylamino) dithiobenzil structure
|
Common Name | 4,4'-Bis(dimethylamino) dithiobenzil | ||
|---|---|---|---|---|
| CAS Number | 41327-18-8 | Molecular Weight | 328.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4'-Bis(dimethylamino) dithiobenzil |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20N2S2 |
|---|---|
| Molecular Weight | 328.5 |
| InChIKey | KKYNFPDZLZBRFI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=S)C(=S)c2ccc(N(C)C)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 41327-18-8? |
| A: Chinese name of 41327-18-8 is 41327-18-8. |
| Q: What is the SMILES notation of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: SMILES notation of 4,4'-Bis(dimethylamino) dithiobenzil is CN(C)c1ccc(C(=S)C(=S)c2ccc(N(C)C)cc2)cc1. |
| Q: What is the InChIKey of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: InChIKey of 4,4'-Bis(dimethylamino) dithiobenzil is KKYNFPDZLZBRFI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: Molecular formula of 4,4'-Bis(dimethylamino) dithiobenzil is C18H20N2S2. |
| Q: What is the English name of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: The English name of 4,4'-Bis(dimethylamino) dithiobenzil is 4,4'-Bis(dimethylamino) dithiobenzil. |
| Q: What is the CAS number of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: CAS number of 4,4'-Bis(dimethylamino) dithiobenzil is 41327-18-8. |
| Q: What is the molecular weight of 4,4'-Bis(dimethylamino) dithiobenzil? |
| A: Molecular weight of 4,4'-Bis(dimethylamino) dithiobenzil is 328.5. |