2-[(3,4-Dichlorophenyl)methyl]-2,3-dihydro-1lambda6,2-benzothiazole-1,1,3-trione structure
|
Common Name | 2-[(3,4-Dichlorophenyl)methyl]-2,3-dihydro-1lambda6,2-benzothiazole-1,1,3-trione | ||
|---|---|---|---|---|
| CAS Number | 41335-48-2 | Molecular Weight | 342.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(3,4-Dichlorophenyl)methyl]-2,3-dihydro-1lambda6,2-benzothiazole-1,1,3-trione |
|---|
| Molecular Formula | C14H9Cl2NO3S |
|---|---|
| Molecular Weight | 342.2 |
| InChIKey | QNAYKUVQVOCFQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)CC3=CC(=C(C=C3)Cl)Cl |
|
Name: Inhibition of human carbonic anhydrase 12 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 12
External Id: CHEMBL3129538
|
|
Name: Inhibition of human carbonic anhydrase 9 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 9
External Id: CHEMBL3129539
|
|
Name: Inhibition of human carbonic anhydrase 1 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL3129540
|
|
Name: Inhibition of human carbonic anhydrase 2 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL3129541
|