(1-Ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid structure
|
Common Name | (1-Ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 41339-67-7 | Molecular Weight | 259.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-Ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO3 |
|---|---|
| Molecular Weight | 259.30000 |
| Exact Mass | 259.12100 |
| PSA | 62.32000 |
| LogP | 2.82060 |
| InChIKey | OVKMSIKSGLLUIS-UHFFFAOYSA-N |
| SMILES | CCC1(CC(=O)O)OCCc2c1[nH]c1ccccc21 |
|
~42%
(1-Ethyl-1,3,4,... CAS#:41339-67-7 |
| Literature: SALMEDIX, INC. Patent: WO2005/33112 A2, 2005 ; Location in patent: Page/Page column 73-74 ; |
|
~%
(1-Ethyl-1,3,4,... CAS#:41339-67-7 |
| Literature: Demerson,C.A. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, p. 189 - 191 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: Antiinflammatory activity of the perorally administered compound assessed in adjuvant...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL782446
|
| 8-Desethyl Etodolac |