butyl 2-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate structure
|
Common Name | butyl 2-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 41339-75-7 | Molecular Weight | 287.35400 | |
| Density | 1.164g/cm3 | Boiling Point | 450.6ºC at 760 mmHg | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.3ºC | |
| Name | butyl 2-(1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 450.6ºC at 760 mmHg |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.35400 |
| Flash Point | 226.3ºC |
| Exact Mass | 287.15200 |
| PSA | 51.32000 |
| LogP | 3.51510 |
| Index of Refraction | 1.578 |
| InChIKey | HKDQDHPIMDDJLV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC1OCCc2c1[nH]c1ccccc21 |
| HS Code | 2934999090 |
|---|
|
~%
butyl 2-(1,3,4,... CAS#:41339-75-7 |
| Literature: Demerson,C.A. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, p. 189 - 191 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AY 23,427 |
| 1-Butyl-1,3,4,9-tetrahydropyrano[3,4-b]indole-1-acetic acid |
| (1-butyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid |
| Pyrano(3,4-b)indole-1-acetic acid,1-butyl-1,3,4,9-tetrahydro |