bis(4-methylphenyl) benzene-1,4-dicarboxylate structure
|
Common Name | bis(4-methylphenyl) benzene-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4135-49-3 | Molecular Weight | 346.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-methylphenyl) benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H18O4 |
|---|---|
| Molecular Weight | 346.37600 |
| Exact Mass | 346.12100 |
| PSA | 52.60000 |
| LogP | 4.74180 |
| InChIKey | XOGHUKBCGNLXOX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(C)cc3)cc2)cc1 |
| HS Code | 2917399090 |
|---|
|
~%
bis(4-methylphe... CAS#:4135-49-3 |
| Literature: Thomas et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 5864,5867 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Terephthalsaeure-di-p-tolylester |
| Terephthalic acid di-p-tolyl ester |
| Bis(4-methylphenyl) terephthalate |
| 1,4-Bis-(p-cresyl)terephthalat |