3,5-dichloro-4-(2,6-dichloro-4-hydroxyphenyl)phenol structure
|
Common Name | 3,5-dichloro-4-(2,6-dichloro-4-hydroxyphenyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 41363-16-0 | Molecular Weight | 323.98700 | |
| Density | 1.624g/cm3 | Boiling Point | 382.8ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | 3,5-dichloro-4-(2,6-dichloro-4-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 382.8ºC at 760 mmHg |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.98700 |
| Flash Point | 185.3ºC |
| Exact Mass | 321.91200 |
| PSA | 40.46000 |
| LogP | 5.37840 |
| Index of Refraction | 1.666 |
| InChIKey | CUBQDFRSSGBHPM-UHFFFAOYSA-N |
| SMILES | Oc1cc(Cl)c(-c2c(Cl)cc(O)cc2Cl)c(Cl)c1 |
| HS Code | 2907299090 |
|---|
|
~%
3,5-dichloro-4-... CAS#:41363-16-0 |
| Literature: Goldschmidt; Suchanek Chemische Berichte, 1957 , vol. 90, p. 19,25 |
|
~%
3,5-dichloro-4-... CAS#:41363-16-0 |
| Literature: Goldschmidt; Suchanek Chemische Berichte, 1957 , vol. 90, p. 19,25 |
|
~%
3,5-dichloro-4-... CAS#:41363-16-0 |
| Literature: Goldschmidt; Suchanek Chemische Berichte, 1957 , vol. 90, p. 19,25 |
|
~%
3,5-dichloro-4-... CAS#:41363-16-0 |
| Literature: Goldschmidt; Suchanek Chemische Berichte, 1957 , vol. 90, p. 19,25 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,6,2',6'-Tetrachlor-biphenyl-4,4'-diol |
| 4,4'-Dihydroxy-2,6,2',6'-tetrachlordiphenyl |
| (1,1'-Biphenyl)-4,4'-diol,2,2',6,6'-tetrachloro |
| 2,6,2',6'-tetrachloro-biphenyl-4,4'-diol |