2-[4-(3-oxocyclohexen-1-yl)phenyl]acetic acid structure
|
Common Name | 2-[4-(3-oxocyclohexen-1-yl)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 41387-02-4 | Molecular Weight | 230.25900 | |
| Density | 1.238g/cm3 | Boiling Point | 409.2ºC at 760mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | 2-[4-(3-oxocyclohexen-1-yl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 215.4ºC |
| Exact Mass | 230.09400 |
| PSA | 54.37000 |
| LogP | 2.45010 |
| Index of Refraction | 1.592 |
| InChIKey | SRJYOCXLFRUMBY-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(C2=CC(=O)CCC2)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(3'-Oxo-1'-cyclohexenyl)phenylacetic acid |
| (p-(3-Oxo-1-cyclohexen-1-yl)phenyl)acetic acid |
| UNII-3578QN1B5H |
| Lexofenac [INN] |
| Lexofenac |